C9H2F16O — CID 87966898
1,1,2,2,3,3,4,4,6,6,7,7,8,8,9,9-hexadecafluorononan-5-one (PubChem CID 87966898) has the molecular formula C9H2F16O and a molecular weight of 430.08 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,6,6,7,7,8,8,9,9-hexadecafluorononan-5-one.
| Compound Name | 1,1,2,2,3,3,4,4,6,6,7,7,8,8,9,9-hexadecafluorononan-5-one |
|---|---|
| PubChem CID | 87966898 |
| Molecular Formula | C9H2F16O |
| Molecular Weight | 430.08 g/mol |
| Exact Mass | 429.99 |
| IUPAC Name | 1,1,2,2,3,3,4,4,6,6,7,7,8,8,9,9-hexadecafluorononan-5-one |
| SMILES | O=C(C(F)(F)C(F)(F)C(F)(F)C(F)F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H2F16O/c10-2(11)6(18,19)8(22,23)4(14,15)1(26)5(16,17)9(24,25)7(20,21)3(12)13/h2-3H |
| InChIKey | WXTGITZIMZPFAY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.08 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|