About 2-oxabicyclo[2.2.2]oct-1(6)-ene-5,8-diamine
2-oxabicyclo[2.2.2]oct-1(6)-ene-5,8-diamine (PubChem CID 87967010) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 2-oxabicyclo[2.2.2]oct-1(6)-ene-5,8-diamine.
Molecular Properties
| Compound Name | 2-oxabicyclo[2.2.2]oct-1(6)-ene-5,8-diamine |
| PubChem CID | 87967010 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 2-oxabicyclo[2.2.2]oct-1(6)-ene-5,8-diamine |
| SMILES | NC1C=C2CC(N)C1CO2 |
| InChI | InChI=1S/C7H12N2O/c8-6-1-4-2-7(9)5(6)3-10-4/h1,5-7H,2-3,8-9H2 |
| InChIKey | JVATYSGJFVRWJT-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-oxabicyclo[2.2.2]oct-1(6)-ene-5,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxabicyclo[2.2.2]oct-1(6)-ene-5,8-diamine?
The IUPAC name of 2-oxabicyclo[2.2.2]oct-1(6)-ene-5,8-diamine (CID 87967010) is 2-oxabicyclo[2.2.2]oct-1(6)-ene-5,8-diamine.
What is the SMILES notation for 2-oxabicyclo[2.2.2]oct-1(6)-ene-5,8-diamine?
The canonical SMILES for 2-oxabicyclo[2.2.2]oct-1(6)-ene-5,8-diamine is NC1C=C2CC(N)C1CO2.
What is the InChIKey of 2-oxabicyclo[2.2.2]oct-1(6)-ene-5,8-diamine?
The InChIKey is JVATYSGJFVRWJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c8-6-1-4-2-7(9)5(6)3-10-4/h1,5-7H,2-3,8-9H2.
What are the key properties of 2-oxabicyclo[2.2.2]oct-1(6)-ene-5,8-diamine?
2-oxabicyclo[2.2.2]oct-1(6)-ene-5,8-diamine has a molecular weight of 140.19 g/mol, XLogP of -0.43, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxabicyclo[2.2.2]oct-1(6)-ene-5,8-diamine is sourced from PubChem (CID 87967010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).