About bis[2,3-bis(trifluoromethyl)phenyl]methyl 4-(2-fluoro-4-pentylphenyl)benzoate
bis[2,3-bis(trifluoromethyl)phenyl]methyl 4-(2-fluoro-4-pentylphenyl)benzoate (PubChem CID 87967317) has the molecular formula C35H25F13O2
and a molecular weight of 724.56 g/mol. Its IUPAC name is bis[2,3-bis(trifluoromethyl)phenyl]methyl 4-(2-fluoro-4-pentylphenyl)benzoate.
Molecular Properties
| Compound Name | bis[2,3-bis(trifluoromethyl)phenyl]methyl 4-(2-fluoro-4-pentylphenyl)benzoate |
| PubChem CID | 87967317 |
| Molecular Formula | C35H25F13O2 |
| Molecular Weight | 724.56 g/mol |
| Exact Mass | 724.16 |
| IUPAC Name | bis[2,3-bis(trifluoromethyl)phenyl]methyl 4-(2-fluoro-4-pentylphenyl)benzoate |
| SMILES | CCCCCc1ccc(-c2ccc(C(=O)OC(c3cccc(C(F)(F)F)c3C(F)(F)F)c3cccc(C(F)(F)F)c3C(F)(F)F)cc2)c(F)c1 |
| InChI | InChI=1S/C35H25F13O2/c1-2-3-4-7-19-12-17-22(27(36)18-19)20-13-15-21(16-14-20)31(49)50-30(23-8-5-10-25(32(37,38)39)28(23)34(43,44)45)24-9-6-11-26(33(40,41)42)29(24)35(46,47)48/h5-6,8-18,30H,2-4,7H2,1H3 |
| InChIKey | DBYSCALFXGQRFI-UHFFFAOYSA-N |
| XLogP | 12.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 724.56 |
| LogP ≤ 5 | 12.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze bis[2,3-bis(trifluoromethyl)phenyl]methyl 4-(2-fluoro-4-pentylphenyl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2,3-bis(trifluoromethyl)phenyl]methyl 4-(2-fluoro-4-pentylphenyl)benzoate?
The IUPAC name of bis[2,3-bis(trifluoromethyl)phenyl]methyl 4-(2-fluoro-4-pentylphenyl)benzoate (CID 87967317) is bis[2,3-bis(trifluoromethyl)phenyl]methyl 4-(2-fluoro-4-pentylphenyl)benzoate.
What is the SMILES notation for bis[2,3-bis(trifluoromethyl)phenyl]methyl 4-(2-fluoro-4-pentylphenyl)benzoate?
The canonical SMILES for bis[2,3-bis(trifluoromethyl)phenyl]methyl 4-(2-fluoro-4-pentylphenyl)benzoate is CCCCCc1ccc(-c2ccc(C(=O)OC(c3cccc(C(F)(F)F)c3C(F)(F)F)c3cccc(C(F)(F)F)c3C(F)(F)F)cc2)c(F)c1.
What is the InChIKey of bis[2,3-bis(trifluoromethyl)phenyl]methyl 4-(2-fluoro-4-pentylphenyl)benzoate?
The InChIKey is DBYSCALFXGQRFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H25F13O2/c1-2-3-4-7-19-12-17-22(27(36)18-19)20-13-15-21(16-14-20)31(49)50-30(23-8-5-10-25(32(37,38)39)28(23)34(43,44)45)24-9-6-11-26(33(40,41)42)29(24)35(46,47)48/h5-6,8-18,30H,2-4,7H2,1H3.
What are the key properties of bis[2,3-bis(trifluoromethyl)phenyl]methyl 4-(2-fluoro-4-pentylphenyl)benzoate?
bis[2,3-bis(trifluoromethyl)phenyl]methyl 4-(2-fluoro-4-pentylphenyl)benzoate has a molecular weight of 724.56 g/mol, XLogP of 12.25, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2,3-bis(trifluoromethyl)phenyl]methyl 4-(2-fluoro-4-pentylphenyl)benzoate is sourced from PubChem (CID 87967317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).