About methyl 5-[[4-(2,5-difluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-2-methylfuran-3-carboxylate
methyl 5-[[4-(2,5-difluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-2-methylfuran-3-carboxylate (PubChem CID 8796732) has the molecular formula C18H21F2N2O5S+
and a molecular weight of 415.44 g/mol. Its IUPAC name is methyl 5-[[4-(2,5-difluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-2-methylfuran-3-carboxylate.
Molecular Properties
| Compound Name | methyl 5-[[4-(2,5-difluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-2-methylfuran-3-carboxylate |
| PubChem CID | 8796732 |
| Molecular Formula | C18H21F2N2O5S+ |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | methyl 5-[[4-(2,5-difluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-2-methylfuran-3-carboxylate |
| SMILES | COC(=O)c1cc(C[NH+]2CCN(S(=O)(=O)c3cc(F)ccc3F)CC2)oc1C |
| InChI | InChI=1S/C18H20F2N2O5S/c1-12-15(18(23)26-2)10-14(27-12)11-21-5-7-22(8-6-21)28(24,25)17-9-13(19)3-4-16(17)20/h3-4,9-10H,5-8,11H2,1-2H3/p+1 |
| InChIKey | YGLGKBDUHDRIGU-UHFFFAOYSA-O |
| XLogP | 0.74 |
| TPSA | 81.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-[[4-(2,5-difluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-2-methylfuran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-[[4-(2,5-difluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-2-methylfuran-3-carboxylate?
The IUPAC name of methyl 5-[[4-(2,5-difluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-2-methylfuran-3-carboxylate (CID 8796732) is methyl 5-[[4-(2,5-difluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-2-methylfuran-3-carboxylate.
What is the SMILES notation for methyl 5-[[4-(2,5-difluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-2-methylfuran-3-carboxylate?
The canonical SMILES for methyl 5-[[4-(2,5-difluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-2-methylfuran-3-carboxylate is COC(=O)c1cc(C[NH+]2CCN(S(=O)(=O)c3cc(F)ccc3F)CC2)oc1C.
What is the InChIKey of methyl 5-[[4-(2,5-difluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-2-methylfuran-3-carboxylate?
The InChIKey is YGLGKBDUHDRIGU-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H20F2N2O5S/c1-12-15(18(23)26-2)10-14(27-12)11-21-5-7-22(8-6-21)28(24,25)17-9-13(19)3-4-16(17)20/h3-4,9-10H,5-8,11H2,1-2H3/p+1.
What are the key properties of methyl 5-[[4-(2,5-difluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-2-methylfuran-3-carboxylate?
methyl 5-[[4-(2,5-difluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-2-methylfuran-3-carboxylate has a molecular weight of 415.44 g/mol, XLogP of 0.74, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-[[4-(2,5-difluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-2-methylfuran-3-carboxylate is sourced from PubChem (CID 8796732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).