About methylsulfonyloxymethyl 1-benzyl-4-fluoropiperidine-4-carboxylate
methylsulfonyloxymethyl 1-benzyl-4-fluoropiperidine-4-carboxylate (PubChem CID 87967410) has the molecular formula C15H20FNO5S
and a molecular weight of 345.39 g/mol. Its IUPAC name is methylsulfonyloxymethyl 1-benzyl-4-fluoropiperidine-4-carboxylate.
Molecular Properties
| Compound Name | methylsulfonyloxymethyl 1-benzyl-4-fluoropiperidine-4-carboxylate |
| PubChem CID | 87967410 |
| Molecular Formula | C15H20FNO5S |
| Molecular Weight | 345.39 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | methylsulfonyloxymethyl 1-benzyl-4-fluoropiperidine-4-carboxylate |
| SMILES | CS(=O)(=O)OCOC(=O)C1(F)CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C15H20FNO5S/c1-23(19,20)22-12-21-14(18)15(16)7-9-17(10-8-15)11-13-5-3-2-4-6-13/h2-6H,7-12H2,1H3 |
| InChIKey | HCQXGFQQMYBDEX-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.39 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methylsulfonyloxymethyl 1-benzyl-4-fluoropiperidine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfonyloxymethyl 1-benzyl-4-fluoropiperidine-4-carboxylate?
The IUPAC name of methylsulfonyloxymethyl 1-benzyl-4-fluoropiperidine-4-carboxylate (CID 87967410) is methylsulfonyloxymethyl 1-benzyl-4-fluoropiperidine-4-carboxylate.
What is the SMILES notation for methylsulfonyloxymethyl 1-benzyl-4-fluoropiperidine-4-carboxylate?
The canonical SMILES for methylsulfonyloxymethyl 1-benzyl-4-fluoropiperidine-4-carboxylate is CS(=O)(=O)OCOC(=O)C1(F)CCN(Cc2ccccc2)CC1.
What is the InChIKey of methylsulfonyloxymethyl 1-benzyl-4-fluoropiperidine-4-carboxylate?
The InChIKey is HCQXGFQQMYBDEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20FNO5S/c1-23(19,20)22-12-21-14(18)15(16)7-9-17(10-8-15)11-13-5-3-2-4-6-13/h2-6H,7-12H2,1H3.
What are the key properties of methylsulfonyloxymethyl 1-benzyl-4-fluoropiperidine-4-carboxylate?
methylsulfonyloxymethyl 1-benzyl-4-fluoropiperidine-4-carboxylate has a molecular weight of 345.39 g/mol, XLogP of 1.47, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfonyloxymethyl 1-benzyl-4-fluoropiperidine-4-carboxylate is sourced from PubChem (CID 87967410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).