C14H24N6O2S — CID 87967533
(2R,3S,4S,5R)-2-[6-amino-6-(3-aminopropyl)-5-methylpurin-9-yl]-5-methyl-4-sulfanyloxolan-3-ol (PubChem CID 87967533) has the molecular formula C14H24N6O2S and a molecular weight of 340.45 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-[6-amino-6-(3-aminopropyl)-5-methylpurin-9-yl]-5-methyl-4-sulfanyloxolan-3-ol.
| Compound Name | (2R,3S,4S,5R)-2-[6-amino-6-(3-aminopropyl)-5-methylpurin-9-yl]-5-methyl-4-sulfanyloxolan-3-ol |
|---|---|
| PubChem CID | 87967533 |
| Molecular Formula | C14H24N6O2S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (2R,3S,4S,5R)-2-[6-amino-6-(3-aminopropyl)-5-methylpurin-9-yl]-5-methyl-4-sulfanyloxolan-3-ol |
| SMILES | C[C@H]1O[C@@H](N2C=NC3(C)C2=NC=NC3(N)CCCN)[C@H](O)[C@@H]1S |
| InChI | InChI=1S/C14H24N6O2S/c1-8-10(23)9(21)11(22-8)20-7-19-13(2)12(20)17-6-18-14(13,16)4-3-5-15/h6-11,21,23H,3-5,15-16H2,1-2H3/t8-,9-,10-,11-,13?,14?/m1/s1 |
| InChIKey | BVBJPVJPTREPJD-QKMWJFDDSA-N |
| XLogP | -0.67 |
| TPSA | 121.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|