C42H43FN2NiO2 — CID 87967621
1-N,2-N-bis(2,6-dimethylphenyl)acenaphthylene-1,2-diimine;3,6-ditert-butyl-4-fluorobenzene-1,2-diolate;nickel(2+) (PubChem CID 87967621) has the molecular formula C42H43FN2NiO2 and a molecular weight of 685.51 g/mol. Its IUPAC name is 1-N,2-N-bis(2,6-dimethylphenyl)acenaphthylene-1,2-diimine;3,6-ditert-butyl-4-fluorobenzene-1,2-diolate;nickel(2+).
| Compound Name | 1-N,2-N-bis(2,6-dimethylphenyl)acenaphthylene-1,2-diimine;3,6-ditert-butyl-4-fluorobenzene-1,2-diolate;nickel(2+) |
|---|---|
| PubChem CID | 87967621 |
| Molecular Formula | C42H43FN2NiO2 |
| Molecular Weight | 685.51 g/mol |
| Exact Mass | 684.27 |
| IUPAC Name | 1-N,2-N-bis(2,6-dimethylphenyl)acenaphthylene-1,2-diimine;3,6-ditert-butyl-4-fluorobenzene-1,2-diolate;nickel(2+) |
| SMILES | CC(C)(C)c1cc(F)c(C(C)(C)C)c([O-])c1[O-].Cc1cccc(C)c1/N=C1C(=N/c2c(C)cccc2C)/c2cccc3cccc/1c23.[Ni+2] |
| InChI | InChI=1S/C28H24N2.C14H21FO2.Ni/c1-17-9-5-10-18(2)25(17)29-27-22-15-7-13-21-14-8-16-23(24(21)22)28(27)30-26-19(3)11-6-12-20(26)4;1-13(2,3)8-7-9(15)10(14(4,5)6)12(17)11(8)16;/h5-16H,1-4H3;7,16-17H,1-6H3;/q;;+2/p-2/b29-27+,30-28+;; |
| InChIKey | LSELIRMTAWLNKT-ZQGAZYNISA-L |
| XLogP | 9.89 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.51 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|