About cyclopenta-1,3-dien-1-ylmethyliminovanadium(2+) dichloride
cyclopenta-1,3-dien-1-ylmethyliminovanadium(2+) dichloride (PubChem CID 87968242) has the molecular formula C6H7Cl2NV
and a molecular weight of 214.98 g/mol. Its IUPAC name is cyclopenta-1,3-dien-1-ylmethyliminovanadium(2+) dichloride.
Molecular Properties
| Compound Name | cyclopenta-1,3-dien-1-ylmethyliminovanadium(2+) dichloride |
| PubChem CID | 87968242 |
| Molecular Formula | C6H7Cl2NV |
| Molecular Weight | 214.98 g/mol |
| Exact Mass | 213.94 |
| IUPAC Name | cyclopenta-1,3-dien-1-ylmethyliminovanadium(2+) dichloride |
| SMILES | [Cl-].[Cl-].[V+2]=NCC1=CC=CC1 |
| InChI | InChI=1S/C6H7N.2ClH.V/c7-5-6-3-1-2-4-6;;;/h1-3H,4-5H2;2*1H;/q;;;+2/p-2 |
| InChIKey | MVHTXOCWDVPQOO-UHFFFAOYSA-L |
| XLogP | -4.39 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.98 |
| LogP ≤ 5 | -4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclopenta-1,3-dien-1-ylmethyliminovanadium(2+) dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-dien-1-ylmethyliminovanadium(2+) dichloride?
The IUPAC name of cyclopenta-1,3-dien-1-ylmethyliminovanadium(2+) dichloride (CID 87968242) is cyclopenta-1,3-dien-1-ylmethyliminovanadium(2+) dichloride.
What is the SMILES notation for cyclopenta-1,3-dien-1-ylmethyliminovanadium(2+) dichloride?
The canonical SMILES for cyclopenta-1,3-dien-1-ylmethyliminovanadium(2+) dichloride is [Cl-].[Cl-].[V+2]=NCC1=CC=CC1.
What is the InChIKey of cyclopenta-1,3-dien-1-ylmethyliminovanadium(2+) dichloride?
The InChIKey is MVHTXOCWDVPQOO-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H7N.2ClH.V/c7-5-6-3-1-2-4-6;;;/h1-3H,4-5H2;2*1H;/q;;;+2/p-2.
What are the key properties of cyclopenta-1,3-dien-1-ylmethyliminovanadium(2+) dichloride?
cyclopenta-1,3-dien-1-ylmethyliminovanadium(2+) dichloride has a molecular weight of 214.98 g/mol, XLogP of -4.39, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-dien-1-ylmethyliminovanadium(2+) dichloride is sourced from PubChem (CID 87968242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).