About 1-benzofuran-2-yl-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]methanone
1-benzofuran-2-yl-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]methanone (PubChem CID 8796842) has the molecular formula C21H19N3O2S
and a molecular weight of 377.47 g/mol. Its IUPAC name is 1-benzofuran-2-yl-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]methanone.
Molecular Properties
| Compound Name | 1-benzofuran-2-yl-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]methanone |
| PubChem CID | 8796842 |
| Molecular Formula | C21H19N3O2S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 1-benzofuran-2-yl-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc2ccccc2o1)N1CCN(Cc2nc3ccccc3s2)CC1 |
| InChI | InChI=1S/C21H19N3O2S/c25-21(18-13-15-5-1-3-7-17(15)26-18)24-11-9-23(10-12-24)14-20-22-16-6-2-4-8-19(16)27-20/h1-8,13H,9-12,14H2 |
| InChIKey | QVTRCEXPWFUXIQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 49.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzofuran-2-yl-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran-2-yl-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]methanone?
The IUPAC name of 1-benzofuran-2-yl-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]methanone (CID 8796842) is 1-benzofuran-2-yl-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]methanone.
What is the SMILES notation for 1-benzofuran-2-yl-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]methanone?
The canonical SMILES for 1-benzofuran-2-yl-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]methanone is O=C(c1cc2ccccc2o1)N1CCN(Cc2nc3ccccc3s2)CC1.
What is the InChIKey of 1-benzofuran-2-yl-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]methanone?
The InChIKey is QVTRCEXPWFUXIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O2S/c25-21(18-13-15-5-1-3-7-17(15)26-18)24-11-9-23(10-12-24)14-20-22-16-6-2-4-8-19(16)27-20/h1-8,13H,9-12,14H2.
What are the key properties of 1-benzofuran-2-yl-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]methanone?
1-benzofuran-2-yl-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]methanone has a molecular weight of 377.47 g/mol, XLogP of 4.00, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran-2-yl-[4-(1,3-benzothiazol-2-ylmethyl)piperazin-1-yl]methanone is sourced from PubChem (CID 8796842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).