About 6-bromo-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]thieno[3,2-c]pyridin-4-amine
6-bromo-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]thieno[3,2-c]pyridin-4-amine (PubChem CID 87968546) has the molecular formula C21H14BrFN4S
and a molecular weight of 453.34 g/mol. Its IUPAC name is 6-bromo-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]thieno[3,2-c]pyridin-4-amine.
Molecular Properties
| Compound Name | 6-bromo-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]thieno[3,2-c]pyridin-4-amine |
| PubChem CID | 87968546 |
| Molecular Formula | C21H14BrFN4S |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 452.01 |
| IUPAC Name | 6-bromo-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]thieno[3,2-c]pyridin-4-amine |
| SMILES | Fc1cccc(Cn2ncc3cc(Nc4nc(Br)cc5sccc45)ccc32)c1 |
| InChI | InChI=1S/C21H14BrFN4S/c22-20-10-19-17(6-7-28-19)21(26-20)25-16-4-5-18-14(9-16)11-24-27(18)12-13-2-1-3-15(23)8-13/h1-11H,12H2,(H,25,26) |
| InChIKey | KIDYLDKBWYHDFL-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]thieno[3,2-c]pyridin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]thieno[3,2-c]pyridin-4-amine?
The IUPAC name of 6-bromo-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]thieno[3,2-c]pyridin-4-amine (CID 87968546) is 6-bromo-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]thieno[3,2-c]pyridin-4-amine.
What is the SMILES notation for 6-bromo-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]thieno[3,2-c]pyridin-4-amine?
The canonical SMILES for 6-bromo-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]thieno[3,2-c]pyridin-4-amine is Fc1cccc(Cn2ncc3cc(Nc4nc(Br)cc5sccc45)ccc32)c1.
What is the InChIKey of 6-bromo-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]thieno[3,2-c]pyridin-4-amine?
The InChIKey is KIDYLDKBWYHDFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14BrFN4S/c22-20-10-19-17(6-7-28-19)21(26-20)25-16-4-5-18-14(9-16)11-24-27(18)12-13-2-1-3-15(23)8-13/h1-11H,12H2,(H,25,26).
What are the key properties of 6-bromo-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]thieno[3,2-c]pyridin-4-amine?
6-bromo-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]thieno[3,2-c]pyridin-4-amine has a molecular weight of 453.34 g/mol, XLogP of 6.34, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N-[1-[(3-fluorophenyl)methyl]indazol-5-yl]thieno[3,2-c]pyridin-4-amine is sourced from PubChem (CID 87968546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).