C26H29AsN2O2 — CID 87968651
3,3-bis[4-(dimethylamino)phenyl]-6-dimethylarsanyl-2-benzofuran-1-one (PubChem CID 87968651) has the molecular formula C26H29AsN2O2 and a molecular weight of 476.45 g/mol. Its IUPAC name is 3,3-bis[4-(dimethylamino)phenyl]-6-dimethylarsanyl-2-benzofuran-1-one.
| Compound Name | 3,3-bis[4-(dimethylamino)phenyl]-6-dimethylarsanyl-2-benzofuran-1-one |
|---|---|
| PubChem CID | 87968651 |
| Molecular Formula | C26H29AsN2O2 |
| Molecular Weight | 476.45 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 3,3-bis[4-(dimethylamino)phenyl]-6-dimethylarsanyl-2-benzofuran-1-one |
| SMILES | CN(C)c1ccc(C2(c3ccc(N(C)C)cc3)OC(=O)c3cc([As](C)C)ccc32)cc1 |
| InChI | InChI=1S/C26H29AsN2O2/c1-27(2)20-11-16-24-23(17-20)25(30)31-26(24,18-7-12-21(13-8-18)28(3)4)19-9-14-22(15-10-19)29(5)6/h7-17H,1-6H3 |
| InChIKey | RAOGCFOQIWSWMV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|