About methyl 4-[2-[3,5-dichloro-2-(trifluoromethylsulfonyloxy)phenyl]ethyl]benzoate
methyl 4-[2-[3,5-dichloro-2-(trifluoromethylsulfonyloxy)phenyl]ethyl]benzoate (PubChem CID 87968814) has the molecular formula C17H13Cl2F3O5S
and a molecular weight of 457.25 g/mol. Its IUPAC name is methyl 4-[2-[3,5-dichloro-2-(trifluoromethylsulfonyloxy)phenyl]ethyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-[2-[3,5-dichloro-2-(trifluoromethylsulfonyloxy)phenyl]ethyl]benzoate |
| PubChem CID | 87968814 |
| Molecular Formula | C17H13Cl2F3O5S |
| Molecular Weight | 457.25 g/mol |
| Exact Mass | 455.98 |
| IUPAC Name | methyl 4-[2-[3,5-dichloro-2-(trifluoromethylsulfonyloxy)phenyl]ethyl]benzoate |
| SMILES | COC(=O)c1ccc(CCc2cc(Cl)cc(Cl)c2OS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H13Cl2F3O5S/c1-26-16(23)11-5-2-10(3-6-11)4-7-12-8-13(18)9-14(19)15(12)27-28(24,25)17(20,21)22/h2-3,5-6,8-9H,4,7H2,1H3 |
| InChIKey | VNXJIHJZKZAUQW-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 457.25 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-[2-[3,5-dichloro-2-(trifluoromethylsulfonyloxy)phenyl]ethyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[2-[3,5-dichloro-2-(trifluoromethylsulfonyloxy)phenyl]ethyl]benzoate?
The IUPAC name of methyl 4-[2-[3,5-dichloro-2-(trifluoromethylsulfonyloxy)phenyl]ethyl]benzoate (CID 87968814) is methyl 4-[2-[3,5-dichloro-2-(trifluoromethylsulfonyloxy)phenyl]ethyl]benzoate.
What is the SMILES notation for methyl 4-[2-[3,5-dichloro-2-(trifluoromethylsulfonyloxy)phenyl]ethyl]benzoate?
The canonical SMILES for methyl 4-[2-[3,5-dichloro-2-(trifluoromethylsulfonyloxy)phenyl]ethyl]benzoate is COC(=O)c1ccc(CCc2cc(Cl)cc(Cl)c2OS(=O)(=O)C(F)(F)F)cc1.
What is the InChIKey of methyl 4-[2-[3,5-dichloro-2-(trifluoromethylsulfonyloxy)phenyl]ethyl]benzoate?
The InChIKey is VNXJIHJZKZAUQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13Cl2F3O5S/c1-26-16(23)11-5-2-10(3-6-11)4-7-12-8-13(18)9-14(19)15(12)27-28(24,25)17(20,21)22/h2-3,5-6,8-9H,4,7H2,1H3.
What are the key properties of methyl 4-[2-[3,5-dichloro-2-(trifluoromethylsulfonyloxy)phenyl]ethyl]benzoate?
methyl 4-[2-[3,5-dichloro-2-(trifluoromethylsulfonyloxy)phenyl]ethyl]benzoate has a molecular weight of 457.25 g/mol, XLogP of 4.79, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[2-[3,5-dichloro-2-(trifluoromethylsulfonyloxy)phenyl]ethyl]benzoate is sourced from PubChem (CID 87968814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).