C12H15AsN2O — CID 87968844
CID 87968844 (PubChem CID 87968844) has the molecular formula C12H15AsN2O and a molecular weight of 278.19 g/mol.
| Compound Name | CID 87968844 |
|---|---|
| PubChem CID | 87968844 |
| Molecular Formula | C12H15AsN2O |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | — |
| SMILES | CN1CCC(C(=O)c2ccccn2)CC1[As] |
| InChI | InChI=1S/C12H15AsN2O/c1-15-7-5-9(8-11(15)13)12(16)10-4-2-3-6-14-10/h2-4,6,9,11H,5,7-8H2,1H3 |
| InChIKey | MLWCZWWDHGLPBE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|