About CID 87968844
CID 87968844 (PubChem CID 87968844) has the molecular formula C12H15AsN2O
and a molecular weight of 278.19 g/mol.
Molecular Properties
| Compound Name | CID 87968844 |
| PubChem CID | 87968844 |
| Molecular Formula | C12H15AsN2O |
| Molecular Weight | 278.19 g/mol |
| Exact Mass | 278.04 |
| IUPAC Name | — |
| SMILES | CN1CCC(C(=O)c2ccccn2)CC1[As] |
| InChI | InChI=1S/C12H15AsN2O/c1-15-7-5-9(8-11(15)13)12(16)10-4-2-3-6-14-10/h2-4,6,9,11H,5,7-8H2,1H3 |
| InChIKey | MLWCZWWDHGLPBE-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 87968844 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87968844?
The IUPAC name of CID 87968844 (CID 87968844) is not available.
What is the SMILES notation for CID 87968844?
The canonical SMILES for CID 87968844 is CN1CCC(C(=O)c2ccccn2)CC1[As].
What is the InChIKey of CID 87968844?
The InChIKey is MLWCZWWDHGLPBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15AsN2O/c1-15-7-5-9(8-11(15)13)12(16)10-4-2-3-6-14-10/h2-4,6,9,11H,5,7-8H2,1H3.
What are the key properties of CID 87968844?
CID 87968844 has a molecular weight of 278.19 g/mol, XLogP of 1.10, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87968844 is sourced from PubChem (CID 87968844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).