C30H33F6N7O7 — CID 87968975
methyl (2R)-2-[[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carbonyl]amino]-2-phenylacetate;bis(2,2,2-trifluoroacetic acid) (PubChem CID 87968975) has the molecular formula C30H33F6N7O7 and a molecular weight of 717.62 g/mol. Its IUPAC name is methyl (2R)-2-[[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carbonyl]amino]-2-phenylacetate;bis(2,2,2-trifluoroacetic acid).
| Compound Name | methyl (2R)-2-[[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carbonyl]amino]-2-phenylacetate;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 87968975 |
| Molecular Formula | C30H33F6N7O7 |
| Molecular Weight | 717.62 g/mol |
| Exact Mass | 717.23 |
| IUPAC Name | methyl (2R)-2-[[4-[[2-(diaminomethylideneamino)cyclohexyl]amino]-6-methylquinazoline-2-carbonyl]amino]-2-phenylacetate;bis(2,2,2-trifluoroacetic acid) |
| SMILES | COC(=O)[C@H](NC(=O)c1nc(NC2CCCCC2N=C(N)N)c2cc(C)ccc2n1)c1ccccc1.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H31N7O3.2C2HF3O2/c1-15-12-13-18-17(14-15)22(30-19-10-6-7-11-20(19)31-26(27)28)33-23(29-18)24(34)32-21(25(35)36-2)16-8-4-3-5-9-16;2*3-2(4,5)1(6)7/h3-5,8-9,12-14,19-21H,6-7,10-11H2,1-2H3,(H,32,34)(H4,27,28,31)(H,29,30,33);2*(H,6,7)/t19?,20?,21-;;/m1../s1 |
| InChIKey | HLMOYZOMYLOESY-VVNTWGFASA-N |
| XLogP | 3.85 |
| TPSA | 232.21 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.62 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|