About 1-amino-1-(cyanomethyl)guanidine;formonitrile
1-amino-1-(cyanomethyl)guanidine;formonitrile (PubChem CID 87969037) has the molecular formula C4H8N6
and a molecular weight of 140.15 g/mol. Its IUPAC name is 1-amino-1-(cyanomethyl)guanidine;formonitrile.
Molecular Properties
| Compound Name | 1-amino-1-(cyanomethyl)guanidine;formonitrile |
| PubChem CID | 87969037 |
| Molecular Formula | C4H8N6 |
| Molecular Weight | 140.15 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 1-amino-1-(cyanomethyl)guanidine;formonitrile |
| SMILES | C#N.[H]/N=C(\N)N(N)CC#N |
| InChI | InChI=1S/C3H7N5.CHN/c4-1-2-8(7)3(5)6;1-2/h2,7H2,(H3,5,6);1H |
| InChIKey | PQODUBQHYIENQW-UHFFFAOYSA-N |
| XLogP | -1.28 |
| TPSA | 126.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.15 |
| LogP ≤ 5 | -1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-amino-1-(cyanomethyl)guanidine;formonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-amino-1-(cyanomethyl)guanidine;formonitrile?
The IUPAC name of 1-amino-1-(cyanomethyl)guanidine;formonitrile (CID 87969037) is 1-amino-1-(cyanomethyl)guanidine;formonitrile.
What is the SMILES notation for 1-amino-1-(cyanomethyl)guanidine;formonitrile?
The canonical SMILES for 1-amino-1-(cyanomethyl)guanidine;formonitrile is C#N.[H]/N=C(\N)N(N)CC#N.
What is the InChIKey of 1-amino-1-(cyanomethyl)guanidine;formonitrile?
The InChIKey is PQODUBQHYIENQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7N5.CHN/c4-1-2-8(7)3(5)6;1-2/h2,7H2,(H3,5,6);1H.
What are the key properties of 1-amino-1-(cyanomethyl)guanidine;formonitrile?
1-amino-1-(cyanomethyl)guanidine;formonitrile has a molecular weight of 140.15 g/mol, XLogP of -1.28, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-amino-1-(cyanomethyl)guanidine;formonitrile is sourced from PubChem (CID 87969037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).