About 1-nitro-N-prop-2-ynyl-2,3-dihydroinden-1-amine
1-nitro-N-prop-2-ynyl-2,3-dihydroinden-1-amine (PubChem CID 87969539) has the molecular formula C12H12N2O2
and a molecular weight of 216.24 g/mol. Its IUPAC name is 1-nitro-N-prop-2-ynyl-2,3-dihydroinden-1-amine.
Molecular Properties
| Compound Name | 1-nitro-N-prop-2-ynyl-2,3-dihydroinden-1-amine |
| PubChem CID | 87969539 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 1-nitro-N-prop-2-ynyl-2,3-dihydroinden-1-amine |
| SMILES | C#CCNC1([N+](=O)[O-])CCc2ccccc21 |
| InChI | InChI=1S/C12H12N2O2/c1-2-9-13-12(14(15)16)8-7-10-5-3-4-6-11(10)12/h1,3-6,13H,7-9H2 |
| InChIKey | KCLQUXNWTYHFEA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitro-N-prop-2-ynyl-2,3-dihydroinden-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitro-N-prop-2-ynyl-2,3-dihydroinden-1-amine?
The IUPAC name of 1-nitro-N-prop-2-ynyl-2,3-dihydroinden-1-amine (CID 87969539) is 1-nitro-N-prop-2-ynyl-2,3-dihydroinden-1-amine.
What is the SMILES notation for 1-nitro-N-prop-2-ynyl-2,3-dihydroinden-1-amine?
The canonical SMILES for 1-nitro-N-prop-2-ynyl-2,3-dihydroinden-1-amine is C#CCNC1([N+](=O)[O-])CCc2ccccc21.
What is the InChIKey of 1-nitro-N-prop-2-ynyl-2,3-dihydroinden-1-amine?
The InChIKey is KCLQUXNWTYHFEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2/c1-2-9-13-12(14(15)16)8-7-10-5-3-4-6-11(10)12/h1,3-6,13H,7-9H2.
What are the key properties of 1-nitro-N-prop-2-ynyl-2,3-dihydroinden-1-amine?
1-nitro-N-prop-2-ynyl-2,3-dihydroinden-1-amine has a molecular weight of 216.24 g/mol, XLogP of 1.29, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitro-N-prop-2-ynyl-2,3-dihydroinden-1-amine is sourced from PubChem (CID 87969539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).