C13H15F2N3O2S — CID 8797022
(2S)-2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]propanenitrile (PubChem CID 8797022) has the molecular formula C13H15F2N3O2S and a molecular weight of 315.34 g/mol. Its IUPAC name is (2S)-2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]propanenitrile.
| Compound Name | (2S)-2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]propanenitrile |
|---|---|
| PubChem CID | 8797022 |
| Molecular Formula | C13H15F2N3O2S |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.09 |
| IUPAC Name | (2S)-2-[4-(2,5-difluorophenyl)sulfonylpiperazin-1-yl]propanenitrile |
| SMILES | C[C@@H](C#N)N1CCN(S(=O)(=O)c2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C13H15F2N3O2S/c1-10(9-16)17-4-6-18(7-5-17)21(19,20)13-8-11(14)2-3-12(13)15/h2-3,8,10H,4-7H2,1H3/t10-/m0/s1 |
| InChIKey | UFNPGULKIVRZDI-JTQLQIEISA-N |
| XLogP | 1.18 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |