About 2-[2-amino-2,4-dimethyl-3-[(6-methyl-3-pyridinyl)methyl]-1,3-thiazol-5-yl]ethanol
2-[2-amino-2,4-dimethyl-3-[(6-methyl-3-pyridinyl)methyl]-1,3-thiazol-5-yl]ethanol (PubChem CID 87970242) has the molecular formula C14H21N3OS
and a molecular weight of 279.41 g/mol. Its IUPAC name is 2-[2-amino-2,4-dimethyl-3-[(6-methyl-3-pyridinyl)methyl]-1,3-thiazol-5-yl]ethanol.
Molecular Properties
| Compound Name | 2-[2-amino-2,4-dimethyl-3-[(6-methyl-3-pyridinyl)methyl]-1,3-thiazol-5-yl]ethanol |
| PubChem CID | 87970242 |
| Molecular Formula | C14H21N3OS |
| Molecular Weight | 279.41 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-[2-amino-2,4-dimethyl-3-[(6-methyl-3-pyridinyl)methyl]-1,3-thiazol-5-yl]ethanol |
| SMILES | CC1=C(CCO)SC(C)(N)N1Cc1ccc(C)nc1 |
| InChI | InChI=1S/C14H21N3OS/c1-10-4-5-12(8-16-10)9-17-11(2)13(6-7-18)19-14(17,3)15/h4-5,8,18H,6-7,9,15H2,1-3H3 |
| InChIKey | LCCSOINHZLEADP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[2-amino-2,4-dimethyl-3-[(6-methyl-3-pyridinyl)methyl]-1,3-thiazol-5-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-amino-2,4-dimethyl-3-[(6-methyl-3-pyridinyl)methyl]-1,3-thiazol-5-yl]ethanol?
The IUPAC name of 2-[2-amino-2,4-dimethyl-3-[(6-methyl-3-pyridinyl)methyl]-1,3-thiazol-5-yl]ethanol (CID 87970242) is 2-[2-amino-2,4-dimethyl-3-[(6-methyl-3-pyridinyl)methyl]-1,3-thiazol-5-yl]ethanol.
What is the SMILES notation for 2-[2-amino-2,4-dimethyl-3-[(6-methyl-3-pyridinyl)methyl]-1,3-thiazol-5-yl]ethanol?
The canonical SMILES for 2-[2-amino-2,4-dimethyl-3-[(6-methyl-3-pyridinyl)methyl]-1,3-thiazol-5-yl]ethanol is CC1=C(CCO)SC(C)(N)N1Cc1ccc(C)nc1.
What is the InChIKey of 2-[2-amino-2,4-dimethyl-3-[(6-methyl-3-pyridinyl)methyl]-1,3-thiazol-5-yl]ethanol?
The InChIKey is LCCSOINHZLEADP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3OS/c1-10-4-5-12(8-16-10)9-17-11(2)13(6-7-18)19-14(17,3)15/h4-5,8,18H,6-7,9,15H2,1-3H3.
What are the key properties of 2-[2-amino-2,4-dimethyl-3-[(6-methyl-3-pyridinyl)methyl]-1,3-thiazol-5-yl]ethanol?
2-[2-amino-2,4-dimethyl-3-[(6-methyl-3-pyridinyl)methyl]-1,3-thiazol-5-yl]ethanol has a molecular weight of 279.41 g/mol, XLogP of 2.19, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-amino-2,4-dimethyl-3-[(6-methyl-3-pyridinyl)methyl]-1,3-thiazol-5-yl]ethanol is sourced from PubChem (CID 87970242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).