C29H35F3O7 — CID 87970326
(1-ethylcyclopentyl) bicyclo[2.2.1]hept-5-ene-2-carboxylate;furan-2,5-dione;2,2,2-trifluoroethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 87970326) has the molecular formula C29H35F3O7 and a molecular weight of 552.59 g/mol. Its IUPAC name is (1-ethylcyclopentyl) bicyclo[2.2.1]hept-5-ene-2-carboxylate;furan-2,5-dione;2,2,2-trifluoroethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | (1-ethylcyclopentyl) bicyclo[2.2.1]hept-5-ene-2-carboxylate;furan-2,5-dione;2,2,2-trifluoroethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 87970326 |
| Molecular Formula | C29H35F3O7 |
| Molecular Weight | 552.59 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | (1-ethylcyclopentyl) bicyclo[2.2.1]hept-5-ene-2-carboxylate;furan-2,5-dione;2,2,2-trifluoroethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CCC1(OC(=O)C2CC3C=CC2C3)CCCC1.O=C(OCC(F)(F)F)C1CC2C=CC1C2.O=C1C=CC(=O)O1 |
| InChI | InChI=1S/C15H22O2.C10H11F3O2.C4H2O3/c1-2-15(7-3-4-8-15)17-14(16)13-10-11-5-6-12(13)9-11;11-10(12,13)5-15-9(14)8-4-6-1-2-7(8)3-6;5-3-1-2-4(6)7-3/h5-6,11-13H,2-4,7-10H2,1H3;1-2,6-8H,3-5H2;1-2H |
| InChIKey | MUAXBLHTBVQKEX-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.59 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|