C12HF18NO2 — CID 87970597
3-fluoro-4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)pyrrole-2,5-dione (PubChem CID 87970597) has the molecular formula C12HF18NO2 and a molecular weight of 533.11 g/mol. Its IUPAC name is 3-fluoro-4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)pyrrole-2,5-dione.
| Compound Name | 3-fluoro-4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 87970597 |
| Molecular Formula | C12HF18NO2 |
| Molecular Weight | 533.11 g/mol |
| Exact Mass | 532.97 |
| IUPAC Name | 3-fluoro-4-(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctyl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)=C1F |
| InChI | InChI=1S/C12HF18NO2/c13-2-1(3(32)31-4(2)33)5(14,15)6(16,17)7(18,19)8(20,21)9(22,23)10(24,25)11(26,27)12(28,29)30/h(H,31,32,33) |
| InChIKey | LZIOYALCXKRFCG-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.11 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|