About 3-chloro-2-N-fluoro-6-N,6-N-dimethyloctane-2,6-diamine
3-chloro-2-N-fluoro-6-N,6-N-dimethyloctane-2,6-diamine (PubChem CID 87970672) has the molecular formula C10H22ClFN2
and a molecular weight of 224.75 g/mol. Its IUPAC name is 3-chloro-2-N-fluoro-6-N,6-N-dimethyloctane-2,6-diamine.
Molecular Properties
| Compound Name | 3-chloro-2-N-fluoro-6-N,6-N-dimethyloctane-2,6-diamine |
| PubChem CID | 87970672 |
| Molecular Formula | C10H22ClFN2 |
| Molecular Weight | 224.75 g/mol |
| Exact Mass | 224.15 |
| IUPAC Name | 3-chloro-2-N-fluoro-6-N,6-N-dimethyloctane-2,6-diamine |
| SMILES | CCC(CCC(Cl)C(C)NF)N(C)C |
| InChI | InChI=1S/C10H22ClFN2/c1-5-9(14(3)4)6-7-10(11)8(2)13-12/h8-10,13H,5-7H2,1-4H3 |
| InChIKey | NPOZBASPALZHEF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.75 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-N-fluoro-6-N,6-N-dimethyloctane-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-N-fluoro-6-N,6-N-dimethyloctane-2,6-diamine?
The IUPAC name of 3-chloro-2-N-fluoro-6-N,6-N-dimethyloctane-2,6-diamine (CID 87970672) is 3-chloro-2-N-fluoro-6-N,6-N-dimethyloctane-2,6-diamine.
What is the SMILES notation for 3-chloro-2-N-fluoro-6-N,6-N-dimethyloctane-2,6-diamine?
The canonical SMILES for 3-chloro-2-N-fluoro-6-N,6-N-dimethyloctane-2,6-diamine is CCC(CCC(Cl)C(C)NF)N(C)C.
What is the InChIKey of 3-chloro-2-N-fluoro-6-N,6-N-dimethyloctane-2,6-diamine?
The InChIKey is NPOZBASPALZHEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22ClFN2/c1-5-9(14(3)4)6-7-10(11)8(2)13-12/h8-10,13H,5-7H2,1-4H3.
What are the key properties of 3-chloro-2-N-fluoro-6-N,6-N-dimethyloctane-2,6-diamine?
3-chloro-2-N-fluoro-6-N,6-N-dimethyloctane-2,6-diamine has a molecular weight of 224.75 g/mol, XLogP of 2.58, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-N-fluoro-6-N,6-N-dimethyloctane-2,6-diamine is sourced from PubChem (CID 87970672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).