C11H14F11N — CID 87970777
1,1,1,2,2,3,3,5,6,9,10-undecafluoroundecan-4-amine (PubChem CID 87970777) has the molecular formula C11H14F11N and a molecular weight of 369.22 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,5,6,9,10-undecafluoroundecan-4-amine.
| Compound Name | 1,1,1,2,2,3,3,5,6,9,10-undecafluoroundecan-4-amine |
|---|---|
| PubChem CID | 87970777 |
| Molecular Formula | C11H14F11N |
| Molecular Weight | 369.22 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 1,1,1,2,2,3,3,5,6,9,10-undecafluoroundecan-4-amine |
| SMILES | CC(F)C(F)CCC(F)C(F)C(N)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H14F11N/c1-4(12)5(13)2-3-6(14)7(15)8(23)9(16,17)10(18,19)11(20,21)22/h4-8H,2-3,23H2,1H3 |
| InChIKey | HITSUKBBFCFRTR-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.22 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|