C8H14Br4 — CID 87971096
2,3,4,5-tetrabromo-2,5-dimethylhexane (PubChem CID 87971096) has the molecular formula C8H14Br4 and a molecular weight of 429.82 g/mol. Its IUPAC name is 2,3,4,5-tetrabromo-2,5-dimethylhexane.
| Compound Name | 2,3,4,5-tetrabromo-2,5-dimethylhexane |
|---|---|
| PubChem CID | 87971096 |
| Molecular Formula | C8H14Br4 |
| Molecular Weight | 429.82 g/mol |
| Exact Mass | 425.78 |
| IUPAC Name | 2,3,4,5-tetrabromo-2,5-dimethylhexane |
| SMILES | CC(C)(Br)C(Br)C(Br)C(C)(C)Br |
| InChI | InChI=1S/C8H14Br4/c1-7(2,11)5(9)6(10)8(3,4)12/h5-6H,1-4H3 |
| InChIKey | WMBQPYMWHOVRMW-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.82 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|