C60H66F3N9O8 — CID 87971167
tris[4-[[(2R)-6-amino-2-benzamidohexanoyl]amino]phenyl]methyl 2,2,2-trifluoroacetate (PubChem CID 87971167) has the molecular formula C60H66F3N9O8 and a molecular weight of 1098.24 g/mol. Its IUPAC name is tris[4-[[(2R)-6-amino-2-benzamidohexanoyl]amino]phenyl]methyl 2,2,2-trifluoroacetate.
| Compound Name | tris[4-[[(2R)-6-amino-2-benzamidohexanoyl]amino]phenyl]methyl 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87971167 |
| Molecular Formula | C60H66F3N9O8 |
| Molecular Weight | 1098.24 g/mol |
| Exact Mass | 1097.50 |
| IUPAC Name | tris[4-[[(2R)-6-amino-2-benzamidohexanoyl]amino]phenyl]methyl 2,2,2-trifluoroacetate |
| SMILES | NCCCC[C@@H](NC(=O)c1ccccc1)C(=O)Nc1ccc(C(OC(=O)C(F)(F)F)(c2ccc(NC(=O)[C@@H](CCCCN)NC(=O)c3ccccc3)cc2)c2ccc(NC(=O)[C@@H](CCCCN)NC(=O)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C60H66F3N9O8/c61-60(62,63)58(79)80-59(43-25-31-46(32-26-43)67-55(76)49(22-10-13-37-64)70-52(73)40-16-4-1-5-17-40,44-27-33-47(34-28-44)68-56(77)50(23-11-14-38-65)71-53(74)41-18-6-2-7-19-41)45-29-35-48(36-30-45)69-57(78)51(24-12-15-39-66)72-54(75)42-20-8-3-9-21-42/h1-9,16-21,25-36,49-51H,10-15,22-24,37-39,64-66H2,(H,67,76)(H,68,77)(H,69,78)(H,70,73)(H,71,74)(H,72,75)/t49-,50-,51-/m1/s1 |
| InChIKey | GRGBIOOKHBINIH-NPGPNXQJSA-N |
| XLogP | 7.68 |
| TPSA | 278.96 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 80 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1098.24 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|