acetic acid;scandium;trifluoromethanesulfonic acid

C3H5F3O5SSc — CID 87971329

IUPACacetic acid;scandium;trifluoromethanesulfonic acid
SMILESCC(=O)O.O=S(=O)(O)C(F)(F)F.[Sc]
InChIInChI=1S/C2H4O2.CHF3O3S.Sc/c1-2(3)4;2-1(3,4)8(5,6)7;/h1H3,(H,3,4);(H,5,6,7);
InChIKeyWMVCXCWRUFSETB-UHFFFAOYSA-N
MW255.08 g/mol
LogP0.48
Rot. Bonds

About acetic acid;scandium;trifluoromethanesulfonic acid

acetic acid;scandium;trifluoromethanesulfonic acid (PubChem CID 87971329) has the molecular formula C3H5F3O5SSc and a molecular weight of 255.08 g/mol. Its IUPAC name is acetic acid;scandium;trifluoromethanesulfonic acid.

Molecular Properties

Compound Nameacetic acid;scandium;trifluoromethanesulfonic acid
PubChem CID87971329
Molecular FormulaC3H5F3O5SSc
Molecular Weight255.08 g/mol
Exact Mass254.94
IUPAC Nameacetic acid;scandium;trifluoromethanesulfonic acid
SMILESCC(=O)O.O=S(=O)(O)C(F)(F)F.[Sc]
InChIInChI=1S/C2H4O2.CHF3O3S.Sc/c1-2(3)4;2-1(3,4)8(5,6)7;/h1H3,(H,3,4);(H,5,6,7);
InChIKeyWMVCXCWRUFSETB-UHFFFAOYSA-N
XLogP0.48
TPSA91.67 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.08
LogP ≤ 50.48
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}

Analyze acetic acid;scandium;trifluoromethanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of acetic acid;scandium;trifluoromethanesulfonic acid?
The IUPAC name of acetic acid;scandium;trifluoromethanesulfonic acid (CID 87971329) is acetic acid;scandium;trifluoromethanesulfonic acid.
What is the SMILES notation for acetic acid;scandium;trifluoromethanesulfonic acid?
The canonical SMILES for acetic acid;scandium;trifluoromethanesulfonic acid is CC(=O)O.O=S(=O)(O)C(F)(F)F.[Sc].
What is the InChIKey of acetic acid;scandium;trifluoromethanesulfonic acid?
The InChIKey is WMVCXCWRUFSETB-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.CHF3O3S.Sc/c1-2(3)4;2-1(3,4)8(5,6)7;/h1H3,(H,3,4);(H,5,6,7);.
What are the key properties of acetic acid;scandium;trifluoromethanesulfonic acid?
acetic acid;scandium;trifluoromethanesulfonic acid has a molecular weight of 255.08 g/mol, XLogP of 0.48, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;scandium;trifluoromethanesulfonic acid is sourced from PubChem (CID 87971329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).