About 1,3-dihydroxy-7-methoxy-10,10a-dihydro-1H-acridin-2-one
1,3-dihydroxy-7-methoxy-10,10a-dihydro-1H-acridin-2-one (PubChem CID 87971511) has the molecular formula C14H13NO4
and a molecular weight of 259.26 g/mol. Its IUPAC name is 1,3-dihydroxy-7-methoxy-10,10a-dihydro-1H-acridin-2-one.
Molecular Properties
| Compound Name | 1,3-dihydroxy-7-methoxy-10,10a-dihydro-1H-acridin-2-one |
| PubChem CID | 87971511 |
| Molecular Formula | C14H13NO4 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 1,3-dihydroxy-7-methoxy-10,10a-dihydro-1H-acridin-2-one |
| SMILES | COC1=CC2=CC3=C(C=C(O)C(=O)C3O)NC2C=C1 |
| InChI | InChI=1S/C14H13NO4/c1-19-8-2-3-10-7(4-8)5-9-11(15-10)6-12(16)14(18)13(9)17/h2-6,10,13,15-17H,1H3 |
| InChIKey | MWOXTJRCYBFGSV-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,3-dihydroxy-7-methoxy-10,10a-dihydro-1H-acridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydroxy-7-methoxy-10,10a-dihydro-1H-acridin-2-one?
The IUPAC name of 1,3-dihydroxy-7-methoxy-10,10a-dihydro-1H-acridin-2-one (CID 87971511) is 1,3-dihydroxy-7-methoxy-10,10a-dihydro-1H-acridin-2-one.
What is the SMILES notation for 1,3-dihydroxy-7-methoxy-10,10a-dihydro-1H-acridin-2-one?
The canonical SMILES for 1,3-dihydroxy-7-methoxy-10,10a-dihydro-1H-acridin-2-one is COC1=CC2=CC3=C(C=C(O)C(=O)C3O)NC2C=C1.
What is the InChIKey of 1,3-dihydroxy-7-methoxy-10,10a-dihydro-1H-acridin-2-one?
The InChIKey is MWOXTJRCYBFGSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO4/c1-19-8-2-3-10-7(4-8)5-9-11(15-10)6-12(16)14(18)13(9)17/h2-6,10,13,15-17H,1H3.
What are the key properties of 1,3-dihydroxy-7-methoxy-10,10a-dihydro-1H-acridin-2-one?
1,3-dihydroxy-7-methoxy-10,10a-dihydro-1H-acridin-2-one has a molecular weight of 259.26 g/mol, XLogP of 0.62, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydroxy-7-methoxy-10,10a-dihydro-1H-acridin-2-one is sourced from PubChem (CID 87971511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).