About (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxane-4-carbaldehyde
(4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxane-4-carbaldehyde (PubChem CID 87972364) has the molecular formula C12H24O4Si
and a molecular weight of 260.41 g/mol. Its IUPAC name is (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxane-4-carbaldehyde.
Molecular Properties
| Compound Name | (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxane-4-carbaldehyde |
| PubChem CID | 87972364 |
| Molecular Formula | C12H24O4Si |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxane-4-carbaldehyde |
| SMILES | CC1OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C=O)O1 |
| InChI | InChI=1S/C12H24O4Si/c1-9-14-8-11(10(7-13)15-9)16-17(5,6)12(2,3)4/h7,9-11H,8H2,1-6H3/t9?,10-,11+/m0/s1 |
| InChIKey | RSDLICUPTIUYHX-QXXIUIOUSA-N |
| XLogP | 2.34 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxane-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxane-4-carbaldehyde?
The IUPAC name of (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxane-4-carbaldehyde (CID 87972364) is (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxane-4-carbaldehyde.
What is the SMILES notation for (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxane-4-carbaldehyde?
The canonical SMILES for (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxane-4-carbaldehyde is CC1OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C=O)O1.
What is the InChIKey of (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxane-4-carbaldehyde?
The InChIKey is RSDLICUPTIUYHX-QXXIUIOUSA-N. The full InChI is InChI=1S/C12H24O4Si/c1-9-14-8-11(10(7-13)15-9)16-17(5,6)12(2,3)4/h7,9-11H,8H2,1-6H3/t9?,10-,11+/m0/s1.
What are the key properties of (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxane-4-carbaldehyde?
(4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxane-4-carbaldehyde has a molecular weight of 260.41 g/mol, XLogP of 2.34, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5R)-5-[tert-butyl(dimethyl)silyl]oxy-2-methyl-1,3-dioxane-4-carbaldehyde is sourced from PubChem (CID 87972364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).