C23H23F3N4O5 — CID 87972747
[2-[4-oxo-3-[2-oxo-2-[2-(pyridin-2-ylamino)ethylamino]ethyl]-2,5-dihydro-1H-3-benzazepin-5-yl]acetyl] 2,2,2-trifluoroacetate (PubChem CID 87972747) has the molecular formula C23H23F3N4O5 and a molecular weight of 492.45 g/mol. Its IUPAC name is [2-[4-oxo-3-[2-oxo-2-[2-(pyridin-2-ylamino)ethylamino]ethyl]-2,5-dihydro-1H-3-benzazepin-5-yl]acetyl] 2,2,2-trifluoroacetate.
| Compound Name | [2-[4-oxo-3-[2-oxo-2-[2-(pyridin-2-ylamino)ethylamino]ethyl]-2,5-dihydro-1H-3-benzazepin-5-yl]acetyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87972747 |
| Molecular Formula | C23H23F3N4O5 |
| Molecular Weight | 492.45 g/mol |
| Exact Mass | 492.16 |
| IUPAC Name | [2-[4-oxo-3-[2-oxo-2-[2-(pyridin-2-ylamino)ethylamino]ethyl]-2,5-dihydro-1H-3-benzazepin-5-yl]acetyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(CN1CCc2ccccc2C(CC(=O)OC(=O)C(F)(F)F)C1=O)NCCNc1ccccn1 |
| InChI | InChI=1S/C23H23F3N4O5/c24-23(25,26)22(34)35-20(32)13-17-16-6-2-1-5-15(16)8-12-30(21(17)33)14-19(31)29-11-10-28-18-7-3-4-9-27-18/h1-7,9,17H,8,10-14H2,(H,27,28)(H,29,31) |
| InChIKey | RLDQSMBZDDJCNQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.45 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|