About 2,4-dihydro-1H-pyridin-4-ylium;ethanesulfonate
2,4-dihydro-1H-pyridin-4-ylium;ethanesulfonate (PubChem CID 87973006) has the molecular formula C7H11NO3S
and a molecular weight of 189.24 g/mol. Its IUPAC name is 2,4-dihydro-1H-pyridin-4-ylium;ethanesulfonate.
Molecular Properties
| Compound Name | 2,4-dihydro-1H-pyridin-4-ylium;ethanesulfonate |
| PubChem CID | 87973006 |
| Molecular Formula | C7H11NO3S |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.05 |
| IUPAC Name | 2,4-dihydro-1H-pyridin-4-ylium;ethanesulfonate |
| SMILES | CCS(=O)(=O)[O-].[C+]1=CCNC=C1 |
| InChI | InChI=1S/C5H6N.C2H6O3S/c1-2-4-6-5-3-1;1-2-6(3,4)5/h2-4,6H,5H2;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | ZDJOMLKMVZOFHS-UHFFFAOYSA-M |
| XLogP | 0.01 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dihydro-1H-pyridin-4-ylium;ethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dihydro-1H-pyridin-4-ylium;ethanesulfonate?
The IUPAC name of 2,4-dihydro-1H-pyridin-4-ylium;ethanesulfonate (CID 87973006) is 2,4-dihydro-1H-pyridin-4-ylium;ethanesulfonate.
What is the SMILES notation for 2,4-dihydro-1H-pyridin-4-ylium;ethanesulfonate?
The canonical SMILES for 2,4-dihydro-1H-pyridin-4-ylium;ethanesulfonate is CCS(=O)(=O)[O-].[C+]1=CCNC=C1.
What is the InChIKey of 2,4-dihydro-1H-pyridin-4-ylium;ethanesulfonate?
The InChIKey is ZDJOMLKMVZOFHS-UHFFFAOYSA-M. The full InChI is InChI=1S/C5H6N.C2H6O3S/c1-2-4-6-5-3-1;1-2-6(3,4)5/h2-4,6H,5H2;2H2,1H3,(H,3,4,5)/q+1;/p-1.
What are the key properties of 2,4-dihydro-1H-pyridin-4-ylium;ethanesulfonate?
2,4-dihydro-1H-pyridin-4-ylium;ethanesulfonate has a molecular weight of 189.24 g/mol, XLogP of 0.01, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dihydro-1H-pyridin-4-ylium;ethanesulfonate is sourced from PubChem (CID 87973006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).