C27H34ClFO4 — CID 87973012
ethyl (2E,4E,6E)-7-(8-chloro-7-ethoxy-2,2-dimethyl-4-propan-2-ylchromen-6-yl)-6-fluoro-3-methylocta-2,4,6-trienoate (PubChem CID 87973012) has the molecular formula C27H34ClFO4 and a molecular weight of 477.02 g/mol. Its IUPAC name is ethyl (2E,4E,6E)-7-(8-chloro-7-ethoxy-2,2-dimethyl-4-propan-2-ylchromen-6-yl)-6-fluoro-3-methylocta-2,4,6-trienoate.
| Compound Name | ethyl (2E,4E,6E)-7-(8-chloro-7-ethoxy-2,2-dimethyl-4-propan-2-ylchromen-6-yl)-6-fluoro-3-methylocta-2,4,6-trienoate |
|---|---|
| PubChem CID | 87973012 |
| Molecular Formula | C27H34ClFO4 |
| Molecular Weight | 477.02 g/mol |
| Exact Mass | 476.21 |
| IUPAC Name | ethyl (2E,4E,6E)-7-(8-chloro-7-ethoxy-2,2-dimethyl-4-propan-2-ylchromen-6-yl)-6-fluoro-3-methylocta-2,4,6-trienoate |
| SMILES | CCOC(=O)/C=C(C)/C=C/C(F)=C(/C)c1cc2c(c(Cl)c1OCC)OC(C)(C)C=C2C(C)C |
| InChI | InChI=1S/C27H34ClFO4/c1-9-31-23(30)13-17(5)11-12-22(29)18(6)19-14-20-21(16(3)4)15-27(7,8)33-26(20)24(28)25(19)32-10-2/h11-16H,9-10H2,1-8H3/b12-11+,17-13+,22-18+ |
| InChIKey | DMCRAUKASCMMBD-OCNXMBTNSA-N |
| XLogP | 7.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.02 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|