C26H30N6O4 — CID 87973357
2,5-diethyl-4-methyl-3-[5-[[(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)amino]carbamoyl]furan-2-yl]oxybenzamide (PubChem CID 87973357) has the molecular formula C26H30N6O4 and a molecular weight of 490.56 g/mol. Its IUPAC name is 2,5-diethyl-4-methyl-3-[5-[[(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)amino]carbamoyl]furan-2-yl]oxybenzamide.
| Compound Name | 2,5-diethyl-4-methyl-3-[5-[[(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)amino]carbamoyl]furan-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 87973357 |
| Molecular Formula | C26H30N6O4 |
| Molecular Weight | 490.56 g/mol |
| Exact Mass | 490.23 |
| IUPAC Name | 2,5-diethyl-4-methyl-3-[5-[[(1,3,4-trimethylpyrazolo[5,4-b]pyridin-6-yl)amino]carbamoyl]furan-2-yl]oxybenzamide |
| SMILES | CCc1cc(C(N)=O)c(CC)c(Oc2ccc(C(=O)NNc3cc(C)c4c(C)nn(C)c4n3)o2)c1C |
| InChI | InChI=1S/C26H30N6O4/c1-7-16-12-18(24(27)33)17(8-2)23(14(16)4)36-21-10-9-19(35-21)26(34)30-29-20-11-13(3)22-15(5)31-32(6)25(22)28-20/h9-12H,7-8H2,1-6H3,(H2,27,33)(H,28,29)(H,30,34) |
| InChIKey | UAMQBBPXKJNXRT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 137.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.56 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|