C38H48N8+4 — CID 87973655
trimethyl-[2-phenyl-3,7,8-tris(trimethylazaniumyl)porphyrin-5-yl]azanium (PubChem CID 87973655) has the molecular formula C38H48N8+4 and a molecular weight of 616.86 g/mol. Its IUPAC name is trimethyl-[2-phenyl-3,7,8-tris(trimethylazaniumyl)porphyrin-5-yl]azanium.
| Compound Name | trimethyl-[2-phenyl-3,7,8-tris(trimethylazaniumyl)porphyrin-5-yl]azanium |
|---|---|
| PubChem CID | 87973655 |
| Molecular Formula | C38H48N8+4 |
| Molecular Weight | 616.86 g/mol |
| Exact Mass | 616.40 |
| IUPAC Name | trimethyl-[2-phenyl-3,7,8-tris(trimethylazaniumyl)porphyrin-5-yl]azanium |
| SMILES | C[N+](C)(C)C1=C(c2ccccc2)/C2=C/C3=N/C(=C\C4=N/C(=C\C5=N/C(=C(/[N+](C)(C)C)C1=N2)C([N+](C)(C)C)=C5[N+](C)(C)C)C=C4)C=C3 |
| InChI | InChI=1S/C38H48N8/c1-43(2,3)35-31-24-29-21-19-27(40-29)22-26-18-20-28(39-26)23-30-32(25-16-14-13-15-17-25)36(44(4,5)6)33(41-30)37(45(7,8)9)34(42-31)38(35)46(10,11)12/h13-24H,1-12H3/q+4/b26-22-,27-22-,28-23-,29-24-,30-23-,31-24-,37-33+,37-34+ |
| InChIKey | RRAXVDUKRILTRZ-DXSCRLMCSA-N |
| XLogP | 5.24 |
| TPSA | 49.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.86 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|