C16H24FNO3S — CID 87973730
[3-(4-fluorophenyl)-1-(4-methylpiperidin-3-yl)propyl] methanesulfonate (PubChem CID 87973730) has the molecular formula C16H24FNO3S and a molecular weight of 329.44 g/mol. Its IUPAC name is [3-(4-fluorophenyl)-1-(4-methylpiperidin-3-yl)propyl] methanesulfonate.
| Compound Name | [3-(4-fluorophenyl)-1-(4-methylpiperidin-3-yl)propyl] methanesulfonate |
|---|---|
| PubChem CID | 87973730 |
| Molecular Formula | C16H24FNO3S |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | [3-(4-fluorophenyl)-1-(4-methylpiperidin-3-yl)propyl] methanesulfonate |
| SMILES | CC1CCNCC1C(CCc1ccc(F)cc1)OS(C)(=O)=O |
| InChI | InChI=1S/C16H24FNO3S/c1-12-9-10-18-11-15(12)16(21-22(2,19)20)8-5-13-3-6-14(17)7-4-13/h3-4,6-7,12,15-16,18H,5,8-11H2,1-2H3 |
| InChIKey | KIWGHXJCSZYBHP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|