C18H20FN3O5S — CID 8797485
2-[(3-acetamido-4-methoxyphenyl)sulfonyl-methylamino]-N-(4-fluorophenyl)acetamide (PubChem CID 8797485) has the molecular formula C18H20FN3O5S and a molecular weight of 409.44 g/mol. Its IUPAC name is 2-[(3-acetamido-4-methoxyphenyl)sulfonyl-methylamino]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[(3-acetamido-4-methoxyphenyl)sulfonyl-methylamino]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 8797485 |
| Molecular Formula | C18H20FN3O5S |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | 2-[(3-acetamido-4-methoxyphenyl)sulfonyl-methylamino]-N-(4-fluorophenyl)acetamide |
| SMILES | COc1ccc(S(=O)(=O)N(C)CC(=O)Nc2ccc(F)cc2)cc1NC(C)=O |
| InChI | InChI=1S/C18H20FN3O5S/c1-12(23)20-16-10-15(8-9-17(16)27-3)28(25,26)22(2)11-18(24)21-14-6-4-13(19)5-7-14/h4-10H,11H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | XYNLLYCTPVIEJJ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |