C21H24FO8P — CID 87975005
[5-[2-(2,5-dimethoxybenzoyl)cyclohexyl]-2-fluorophenoxy] dihydrogen phosphate (PubChem CID 87975005) has the molecular formula C21H24FO8P and a molecular weight of 454.39 g/mol. Its IUPAC name is [5-[2-(2,5-dimethoxybenzoyl)cyclohexyl]-2-fluorophenoxy] dihydrogen phosphate.
| Compound Name | [5-[2-(2,5-dimethoxybenzoyl)cyclohexyl]-2-fluorophenoxy] dihydrogen phosphate |
|---|---|
| PubChem CID | 87975005 |
| Molecular Formula | C21H24FO8P |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | [5-[2-(2,5-dimethoxybenzoyl)cyclohexyl]-2-fluorophenoxy] dihydrogen phosphate |
| SMILES | COc1ccc(OC)c(C(=O)C2CCCCC2c2ccc(F)c(OOP(=O)(O)O)c2)c1 |
| InChI | InChI=1S/C21H24FO8P/c1-27-14-8-10-19(28-2)17(12-14)21(23)16-6-4-3-5-15(16)13-7-9-18(22)20(11-13)29-30-31(24,25)26/h7-12,15-16H,3-6H2,1-2H3,(H2,24,25,26) |
| InChIKey | DTXOFLIKSHVFED-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|