C21H18F18O2 — CID 87975033
[2-(2-bicyclo[2.2.1]heptanyl)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecan-2-yl] 2-(trifluoromethyl)prop-2-enoate (PubChem CID 87975033) has the molecular formula C21H18F18O2 and a molecular weight of 644.34 g/mol. Its IUPAC name is [2-(2-bicyclo[2.2.1]heptanyl)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecan-2-yl] 2-(trifluoromethyl)prop-2-enoate.
| Compound Name | [2-(2-bicyclo[2.2.1]heptanyl)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
|---|---|
| PubChem CID | 87975033 |
| Molecular Formula | C21H18F18O2 |
| Molecular Weight | 644.34 g/mol |
| Exact Mass | 644.10 |
| IUPAC Name | [2-(2-bicyclo[2.2.1]heptanyl)-4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecan-2-yl] 2-(trifluoromethyl)prop-2-enoate |
| SMILES | C=C(C(=O)OC(C)(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1CC2CCC1C2)C(F)(F)F |
| InChI | InChI=1S/C21H18F18O2/c1-8(15(24,25)26)12(40)41-13(2,11-6-9-3-4-10(11)5-9)7-14(22,23)16(27,28)17(29,30)18(31,32)19(33,34)20(35,36)21(37,38)39/h9-11H,1,3-7H2,2H3 |
| InChIKey | OPDBLLAGHZLQGP-UHFFFAOYSA-N |
| XLogP | 8.61 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.34 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|