C19H25NO3S2 — CID 87975058
N-benzyl-4-methoxy-N-(2-methyl-4-sulfanylbutyl)benzenesulfonamide (PubChem CID 87975058) has the molecular formula C19H25NO3S2 and a molecular weight of 379.55 g/mol. Its IUPAC name is N-benzyl-4-methoxy-N-(2-methyl-4-sulfanylbutyl)benzenesulfonamide.
| Compound Name | N-benzyl-4-methoxy-N-(2-methyl-4-sulfanylbutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 87975058 |
| Molecular Formula | C19H25NO3S2 |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-benzyl-4-methoxy-N-(2-methyl-4-sulfanylbutyl)benzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)CC(C)CCS)cc1 |
| InChI | InChI=1S/C19H25NO3S2/c1-16(12-13-24)14-20(15-17-6-4-3-5-7-17)25(21,22)19-10-8-18(23-2)9-11-19/h3-11,16,24H,12-15H2,1-2H3 |
| InChIKey | LACDODSVKNPRFP-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|