C29H42N18O2 — CID 87975333
1-N'-[3,5-bis[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-5-N'-(3,5-diacetylphenyl)-1-N,5-N-bis(diaminomethylideneamino)pentanediimidamide (PubChem CID 87975333) has the molecular formula C29H42N18O2 and a molecular weight of 674.78 g/mol. Its IUPAC name is 1-N'-[3,5-bis[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-5-N'-(3,5-diacetylphenyl)-1-N,5-N-bis(diaminomethylideneamino)pentanediimidamide.
| Compound Name | 1-N'-[3,5-bis[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-5-N'-(3,5-diacetylphenyl)-1-N,5-N-bis(diaminomethylideneamino)pentanediimidamide |
|---|---|
| PubChem CID | 87975333 |
| Molecular Formula | C29H42N18O2 |
| Molecular Weight | 674.78 g/mol |
| Exact Mass | 674.37 |
| IUPAC Name | 1-N'-[3,5-bis[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-5-N'-(3,5-diacetylphenyl)-1-N,5-N-bis(diaminomethylideneamino)pentanediimidamide |
| SMILES | CC(=O)c1cc(/N=C(/CCC/C(=N\c2cc(C(C)=NN=C(N)N)cc(C(C)=NN=C(N)N)c2)NN=C(N)N)NN=C(N)N)cc(C(C)=O)c1 |
| InChI | InChI=1S/C29H42N18O2/c1-14(40-44-26(30)31)18-8-19(15(2)41-45-27(32)33)11-22(10-18)38-24(42-46-28(34)35)6-5-7-25(43-47-29(36)37)39-23-12-20(16(3)48)9-21(13-23)17(4)49/h8-13H,5-7H2,1-4H3,(H,38,42)(H,39,43)(H4,30,31,44)(H4,32,33,45)(H4,34,35,46)(H4,36,37,47) |
| InChIKey | URMSKHJLFBIMHT-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 365.24 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.78 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|