C27H20BrClN2O3S2 — CID 87975362
3-[(1-bromonaphthalen-2-yl)methyl]-N-(3-chloro-6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-2-methyl-1H-indole-5-carboxamide (PubChem CID 87975362) has the molecular formula C27H20BrClN2O3S2 and a molecular weight of 599.96 g/mol. Its IUPAC name is 3-[(1-bromonaphthalen-2-yl)methyl]-N-(3-chloro-6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-2-methyl-1H-indole-5-carboxamide.
| Compound Name | 3-[(1-bromonaphthalen-2-yl)methyl]-N-(3-chloro-6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-2-methyl-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 87975362 |
| Molecular Formula | C27H20BrClN2O3S2 |
| Molecular Weight | 599.96 g/mol |
| Exact Mass | 597.98 |
| IUPAC Name | 3-[(1-bromonaphthalen-2-yl)methyl]-N-(3-chloro-6-sulfanylidenecyclohexa-1,3-dien-1-yl)sulfonyl-2-methyl-1H-indole-5-carboxamide |
| SMILES | Cc1[nH]c2ccc(C(=O)NS(=O)(=O)C3=CC(Cl)=CCC3=S)cc2c1Cc1ccc2ccccc2c1Br |
| InChI | InChI=1S/C27H20BrClN2O3S2/c1-15-21(12-17-7-6-16-4-2-3-5-20(16)26(17)28)22-13-18(8-10-23(22)30-15)27(32)31-36(33,34)25-14-19(29)9-11-24(25)35/h2-10,13-14,30H,11-12H2,1H3,(H,31,32) |
| InChIKey | HUNROXFUHDTHQM-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.96 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|