C30H44N18O2 — CID 87975658
1-N'-[3,5-bis[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-6-N'-(3,5-diacetylphenyl)-1-N,6-N-bis(diaminomethylideneamino)hexanediimidamide (PubChem CID 87975658) has the molecular formula C30H44N18O2 and a molecular weight of 688.81 g/mol. Its IUPAC name is 1-N'-[3,5-bis[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-6-N'-(3,5-diacetylphenyl)-1-N,6-N-bis(diaminomethylideneamino)hexanediimidamide.
| Compound Name | 1-N'-[3,5-bis[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-6-N'-(3,5-diacetylphenyl)-1-N,6-N-bis(diaminomethylideneamino)hexanediimidamide |
|---|---|
| PubChem CID | 87975658 |
| Molecular Formula | C30H44N18O2 |
| Molecular Weight | 688.81 g/mol |
| Exact Mass | 688.39 |
| IUPAC Name | 1-N'-[3,5-bis[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-6-N'-(3,5-diacetylphenyl)-1-N,6-N-bis(diaminomethylideneamino)hexanediimidamide |
| SMILES | CC(=O)c1cc(/N=C(/CCCC/C(=N\c2cc(C(C)=NN=C(N)N)cc(C(C)=NN=C(N)N)c2)NN=C(N)N)NN=C(N)N)cc(C(C)=O)c1 |
| InChI | InChI=1S/C30H44N18O2/c1-15(41-45-27(31)32)19-9-20(16(2)42-46-28(33)34)12-23(11-19)39-25(43-47-29(35)36)7-5-6-8-26(44-48-30(37)38)40-24-13-21(17(3)49)10-22(14-24)18(4)50/h9-14H,5-8H2,1-4H3,(H,39,43)(H,40,44)(H4,31,32,45)(H4,33,34,46)(H4,35,36,47)(H4,37,38,48) |
| InChIKey | LZSYSARFYIUARS-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 365.24 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.81 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|