About 2-(1-propan-2-yloxyethyl)cyclopenta-1,3-diene;titanium;dihydrochloride
2-(1-propan-2-yloxyethyl)cyclopenta-1,3-diene;titanium;dihydrochloride (PubChem CID 87975768) has the molecular formula C10H17Cl2OTi-
and a molecular weight of 272.02 g/mol. Its IUPAC name is 2-(1-propan-2-yloxyethyl)cyclopenta-1,3-diene;titanium;dihydrochloride.
Molecular Properties
| Compound Name | 2-(1-propan-2-yloxyethyl)cyclopenta-1,3-diene;titanium;dihydrochloride |
| PubChem CID | 87975768 |
| Molecular Formula | C10H17Cl2OTi- |
| Molecular Weight | 272.02 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | 2-(1-propan-2-yloxyethyl)cyclopenta-1,3-diene;titanium;dihydrochloride |
| SMILES | CC(C)OC(C)C1=[C-]CC=C1.Cl.Cl.[Ti] |
| InChI | InChI=1S/C10H15O.2ClH.Ti/c1-8(2)11-9(3)10-6-4-5-7-10;;;/h4,6,8-9H,5H2,1-3H3;2*1H;/q-1;;; |
| InChIKey | FJYSXALDUCSKSN-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.02 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 2-(1-propan-2-yloxyethyl)cyclopenta-1,3-diene;titanium;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1-propan-2-yloxyethyl)cyclopenta-1,3-diene;titanium;dihydrochloride?
The IUPAC name of 2-(1-propan-2-yloxyethyl)cyclopenta-1,3-diene;titanium;dihydrochloride (CID 87975768) is 2-(1-propan-2-yloxyethyl)cyclopenta-1,3-diene;titanium;dihydrochloride.
What is the SMILES notation for 2-(1-propan-2-yloxyethyl)cyclopenta-1,3-diene;titanium;dihydrochloride?
The canonical SMILES for 2-(1-propan-2-yloxyethyl)cyclopenta-1,3-diene;titanium;dihydrochloride is CC(C)OC(C)C1=[C-]CC=C1.Cl.Cl.[Ti].
What is the InChIKey of 2-(1-propan-2-yloxyethyl)cyclopenta-1,3-diene;titanium;dihydrochloride?
The InChIKey is FJYSXALDUCSKSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15O.2ClH.Ti/c1-8(2)11-9(3)10-6-4-5-7-10;;;/h4,6,8-9H,5H2,1-3H3;2*1H;/q-1;;;.
What are the key properties of 2-(1-propan-2-yloxyethyl)cyclopenta-1,3-diene;titanium;dihydrochloride?
2-(1-propan-2-yloxyethyl)cyclopenta-1,3-diene;titanium;dihydrochloride has a molecular weight of 272.02 g/mol, XLogP of 3.33, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-propan-2-yloxyethyl)cyclopenta-1,3-diene;titanium;dihydrochloride is sourced from PubChem (CID 87975768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).