C17H24OS — CID 87975937
6-butoxy-6-cyclopenta-1,4-dien-1-ylsulfanyl-1,3-dimethylcyclohexa-1,3-diene (PubChem CID 87975937) has the molecular formula C17H24OS and a molecular weight of 276.44 g/mol. Its IUPAC name is 6-butoxy-6-cyclopenta-1,4-dien-1-ylsulfanyl-1,3-dimethylcyclohexa-1,3-diene.
| Compound Name | 6-butoxy-6-cyclopenta-1,4-dien-1-ylsulfanyl-1,3-dimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 87975937 |
| Molecular Formula | C17H24OS |
| Molecular Weight | 276.44 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | 6-butoxy-6-cyclopenta-1,4-dien-1-ylsulfanyl-1,3-dimethylcyclohexa-1,3-diene |
| SMILES | CCCCOC1(SC2=CCC=C2)CC=C(C)C=C1C |
| InChI | InChI=1S/C17H24OS/c1-4-5-12-18-17(19-16-8-6-7-9-16)11-10-14(2)13-15(17)3/h6,8-10,13H,4-5,7,11-12H2,1-3H3 |
| InChIKey | CZUHRZKCDPMKBH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|