About 6-cyclopenta-1,4-dien-1-ylsulfanyl-1-methyl-6-propoxycyclohexa-1,3-diene
6-cyclopenta-1,4-dien-1-ylsulfanyl-1-methyl-6-propoxycyclohexa-1,3-diene (PubChem CID 87976416) has the molecular formula C15H20OS
and a molecular weight of 248.39 g/mol. Its IUPAC name is 6-cyclopenta-1,4-dien-1-ylsulfanyl-1-methyl-6-propoxycyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 6-cyclopenta-1,4-dien-1-ylsulfanyl-1-methyl-6-propoxycyclohexa-1,3-diene |
| PubChem CID | 87976416 |
| Molecular Formula | C15H20OS |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 6-cyclopenta-1,4-dien-1-ylsulfanyl-1-methyl-6-propoxycyclohexa-1,3-diene |
| SMILES | CCCOC1(SC2=CCC=C2)CC=CC=C1C |
| InChI | InChI=1S/C15H20OS/c1-3-12-16-15(11-7-6-8-13(15)2)17-14-9-4-5-10-14/h4,6-10H,3,5,11-12H2,1-2H3 |
| InChIKey | HEVLKIRRKFTHJX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6-cyclopenta-1,4-dien-1-ylsulfanyl-1-methyl-6-propoxycyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-cyclopenta-1,4-dien-1-ylsulfanyl-1-methyl-6-propoxycyclohexa-1,3-diene?
The IUPAC name of 6-cyclopenta-1,4-dien-1-ylsulfanyl-1-methyl-6-propoxycyclohexa-1,3-diene (CID 87976416) is 6-cyclopenta-1,4-dien-1-ylsulfanyl-1-methyl-6-propoxycyclohexa-1,3-diene.
What is the SMILES notation for 6-cyclopenta-1,4-dien-1-ylsulfanyl-1-methyl-6-propoxycyclohexa-1,3-diene?
The canonical SMILES for 6-cyclopenta-1,4-dien-1-ylsulfanyl-1-methyl-6-propoxycyclohexa-1,3-diene is CCCOC1(SC2=CCC=C2)CC=CC=C1C.
What is the InChIKey of 6-cyclopenta-1,4-dien-1-ylsulfanyl-1-methyl-6-propoxycyclohexa-1,3-diene?
The InChIKey is HEVLKIRRKFTHJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20OS/c1-3-12-16-15(11-7-6-8-13(15)2)17-14-9-4-5-10-14/h4,6-10H,3,5,11-12H2,1-2H3.
What are the key properties of 6-cyclopenta-1,4-dien-1-ylsulfanyl-1-methyl-6-propoxycyclohexa-1,3-diene?
6-cyclopenta-1,4-dien-1-ylsulfanyl-1-methyl-6-propoxycyclohexa-1,3-diene has a molecular weight of 248.39 g/mol, XLogP of 4.59, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-cyclopenta-1,4-dien-1-ylsulfanyl-1-methyl-6-propoxycyclohexa-1,3-diene is sourced from PubChem (CID 87976416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).