About 5-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-2-methyl-N-propylbenzenesulfonamide
5-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-2-methyl-N-propylbenzenesulfonamide (PubChem CID 8797644) has the molecular formula C14H20BrNO4S2
and a molecular weight of 410.36 g/mol. Its IUPAC name is 5-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-2-methyl-N-propylbenzenesulfonamide.
Molecular Properties
| Compound Name | 5-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-2-methyl-N-propylbenzenesulfonamide |
| PubChem CID | 8797644 |
| Molecular Formula | C14H20BrNO4S2 |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 409.00 |
| IUPAC Name | 5-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-2-methyl-N-propylbenzenesulfonamide |
| SMILES | CCCN([C@@H]1CCS(=O)(=O)C1)S(=O)(=O)c1cc(Br)ccc1C |
| InChI | InChI=1S/C14H20BrNO4S2/c1-3-7-16(13-6-8-21(17,18)10-13)22(19,20)14-9-12(15)5-4-11(14)2/h4-5,9,13H,3,6-8,10H2,1-2H3/t13-/m1/s1 |
| InChIKey | DOISDUOIEYRYEE-CYBMUJFWSA-N |
| XLogP | 2.35 |
| TPSA | 71.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-2-methyl-N-propylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-2-methyl-N-propylbenzenesulfonamide?
The IUPAC name of 5-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-2-methyl-N-propylbenzenesulfonamide (CID 8797644) is 5-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-2-methyl-N-propylbenzenesulfonamide.
What is the SMILES notation for 5-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-2-methyl-N-propylbenzenesulfonamide?
The canonical SMILES for 5-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-2-methyl-N-propylbenzenesulfonamide is CCCN([C@@H]1CCS(=O)(=O)C1)S(=O)(=O)c1cc(Br)ccc1C.
What is the InChIKey of 5-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-2-methyl-N-propylbenzenesulfonamide?
The InChIKey is DOISDUOIEYRYEE-CYBMUJFWSA-N. The full InChI is InChI=1S/C14H20BrNO4S2/c1-3-7-16(13-6-8-21(17,18)10-13)22(19,20)14-9-12(15)5-4-11(14)2/h4-5,9,13H,3,6-8,10H2,1-2H3/t13-/m1/s1.
What are the key properties of 5-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-2-methyl-N-propylbenzenesulfonamide?
5-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-2-methyl-N-propylbenzenesulfonamide has a molecular weight of 410.36 g/mol, XLogP of 2.35, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-[(3R)-1,1-dioxothiolan-3-yl]-2-methyl-N-propylbenzenesulfonamide is sourced from PubChem (CID 8797644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).