C22H29N3O5S2 — CID 87976513
2-[(7S)-4-(3-aminopropanoyl)-7-[5-(4-ethylphenyl)thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-hydroxyacetamide (PubChem CID 87976513) has the molecular formula C22H29N3O5S2 and a molecular weight of 479.62 g/mol. Its IUPAC name is 2-[(7S)-4-(3-aminopropanoyl)-7-[5-(4-ethylphenyl)thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-hydroxyacetamide.
| Compound Name | 2-[(7S)-4-(3-aminopropanoyl)-7-[5-(4-ethylphenyl)thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 87976513 |
| Molecular Formula | C22H29N3O5S2 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | 2-[(7S)-4-(3-aminopropanoyl)-7-[5-(4-ethylphenyl)thiophen-2-yl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-hydroxyacetamide |
| SMILES | CCc1ccc(-c2ccc([C@@]3(CC(=O)NO)CCN(C(=O)CCN)CCS3(=O)=O)s2)cc1 |
| InChI | InChI=1S/C22H29N3O5S2/c1-2-16-3-5-17(6-4-16)18-7-8-19(31-18)22(15-20(26)24-28)10-12-25(21(27)9-11-23)13-14-32(22,29)30/h3-8,28H,2,9-15,23H2,1H3,(H,24,26)/t22-/m0/s1 |
| InChIKey | XARVZNHPNWPSPK-QFIPXVFZSA-N |
| XLogP | 2.06 |
| TPSA | 129.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|