C19H16O7S — CID 87976537
4-[2-(7-oxo-2,3-dihydropyrano[3,2-h][1,4]benzodioxin-2-yl)ethyl]benzenesulfonic acid (PubChem CID 87976537) has the molecular formula C19H16O7S and a molecular weight of 388.40 g/mol. Its IUPAC name is 4-[2-(7-oxo-2,3-dihydropyrano[3,2-h][1,4]benzodioxin-2-yl)ethyl]benzenesulfonic acid.
| Compound Name | 4-[2-(7-oxo-2,3-dihydropyrano[3,2-h][1,4]benzodioxin-2-yl)ethyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 87976537 |
| Molecular Formula | C19H16O7S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 4-[2-(7-oxo-2,3-dihydropyrano[3,2-h][1,4]benzodioxin-2-yl)ethyl]benzenesulfonic acid |
| SMILES | O=c1ccoc2c3c(ccc12)OCC(CCc1ccc(S(=O)(=O)O)cc1)O3 |
| InChI | InChI=1S/C19H16O7S/c20-16-9-10-24-18-15(16)7-8-17-19(18)26-13(11-25-17)4-1-12-2-5-14(6-3-12)27(21,22)23/h2-3,5-10,13H,1,4,11H2,(H,21,22,23) |
| InChIKey | VJZISMSOSWWQLM-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|