C26H34ClN3O8S2 — CID 87976866
2-[7-[4-(4-chlorophenoxy)phenyl]-4-(dimethylsulfamoyl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide (PubChem CID 87976866) has the molecular formula C26H34ClN3O8S2 and a molecular weight of 616.16 g/mol. Its IUPAC name is 2-[7-[4-(4-chlorophenoxy)phenyl]-4-(dimethylsulfamoyl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide.
| Compound Name | 2-[7-[4-(4-chlorophenoxy)phenyl]-4-(dimethylsulfamoyl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
|---|---|
| PubChem CID | 87976866 |
| Molecular Formula | C26H34ClN3O8S2 |
| Molecular Weight | 616.16 g/mol |
| Exact Mass | 615.15 |
| IUPAC Name | 2-[7-[4-(4-chlorophenoxy)phenyl]-4-(dimethylsulfamoyl)-1,1-dioxo-1,4-thiazepan-7-yl]-N-(oxan-2-yloxy)acetamide |
| SMILES | CN(C)S(=O)(=O)N1CCC(CC(=O)NOC2CCCCO2)(c2ccc(Oc3ccc(Cl)cc3)cc2)S(=O)(=O)CC1 |
| InChI | InChI=1S/C26H34ClN3O8S2/c1-29(2)40(34,35)30-15-14-26(39(32,33)18-16-30,19-24(31)28-38-25-5-3-4-17-36-25)20-6-10-22(11-7-20)37-23-12-8-21(27)9-13-23/h6-13,25H,3-5,14-19H2,1-2H3,(H,28,31) |
| InChIKey | FAEWAXUEFUTPIU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 131.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.16 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|