C22H30N14O — CID 87977053
2-(4-acetylphenyl)-1-[3,5-bis[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-(diaminomethylideneamino)guanidine (PubChem CID 87977053) has the molecular formula C22H30N14O and a molecular weight of 506.58 g/mol. Its IUPAC name is 2-(4-acetylphenyl)-1-[3,5-bis[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-(diaminomethylideneamino)guanidine.
| Compound Name | 2-(4-acetylphenyl)-1-[3,5-bis[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-(diaminomethylideneamino)guanidine |
|---|---|
| PubChem CID | 87977053 |
| Molecular Formula | C22H30N14O |
| Molecular Weight | 506.58 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | 2-(4-acetylphenyl)-1-[3,5-bis[N-(diaminomethylideneamino)-C-methylcarbonimidoyl]phenyl]-3-(diaminomethylideneamino)guanidine |
| SMILES | CC(=O)c1ccc(/N=C(\NN=C(N)N)Nc2cc(C(C)=NN=C(N)N)cc(C(C)=NN=C(N)N)c2)cc1 |
| InChI | InChI=1S/C22H30N14O/c1-11(31-33-19(23)24)15-8-16(12(2)32-34-20(25)26)10-18(9-15)30-22(36-35-21(27)28)29-17-6-4-14(5-7-17)13(3)37/h4-10H,1-3H3,(H4,23,24,33)(H4,25,26,34)(H4,27,28,35)(H2,29,30,36) |
| InChIKey | AQZKLSCDDYVGIT-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 271.41 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.58 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|