C53H78O7 — CID 87977304
[2-(3,5-ditert-butyl-2-hydroxybenzoyl)oxycarbonyl-4,6-bis(2,4,4-trimethylpentan-2-yl)phenyl] 3,5-ditert-butyl-2-hydroxybenzoate (PubChem CID 87977304) has the molecular formula C53H78O7 and a molecular weight of 827.20 g/mol. Its IUPAC name is [2-(3,5-ditert-butyl-2-hydroxybenzoyl)oxycarbonyl-4,6-bis(2,4,4-trimethylpentan-2-yl)phenyl] 3,5-ditert-butyl-2-hydroxybenzoate.
| Compound Name | [2-(3,5-ditert-butyl-2-hydroxybenzoyl)oxycarbonyl-4,6-bis(2,4,4-trimethylpentan-2-yl)phenyl] 3,5-ditert-butyl-2-hydroxybenzoate |
|---|---|
| PubChem CID | 87977304 |
| Molecular Formula | C53H78O7 |
| Molecular Weight | 827.20 g/mol |
| Exact Mass | 826.57 |
| IUPAC Name | [2-(3,5-ditert-butyl-2-hydroxybenzoyl)oxycarbonyl-4,6-bis(2,4,4-trimethylpentan-2-yl)phenyl] 3,5-ditert-butyl-2-hydroxybenzoate |
| SMILES | CC(C)(C)CC(C)(C)c1cc(C(=O)OC(=O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(OC(=O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(C(C)(C)CC(C)(C)C)c1 |
| InChI | InChI=1S/C53H78O7/c1-46(2,3)29-52(19,20)33-25-36(45(58)60-44(57)35-24-32(49(10,11)12)27-38(41(35)55)51(16,17)18)42(39(28-33)53(21,22)30-47(4,5)6)59-43(56)34-23-31(48(7,8)9)26-37(40(34)54)50(13,14)15/h23-28,54-55H,29-30H2,1-22H3 |
| InChIKey | UVYAHJMFFUJCHP-UHFFFAOYSA-N |
| XLogP | 13.93 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.20 |
| LogP ≤ 5 | 13.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|