C24H32N2O4S2 — CID 87977785
2-[(7S)-7-[5-(4-ethylphenyl)thiophen-2-yl]-4-[(E)-3-methylbut-1-enyl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-hydroxyacetamide (PubChem CID 87977785) has the molecular formula C24H32N2O4S2 and a molecular weight of 476.66 g/mol. Its IUPAC name is 2-[(7S)-7-[5-(4-ethylphenyl)thiophen-2-yl]-4-[(E)-3-methylbut-1-enyl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-hydroxyacetamide.
| Compound Name | 2-[(7S)-7-[5-(4-ethylphenyl)thiophen-2-yl]-4-[(E)-3-methylbut-1-enyl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 87977785 |
| Molecular Formula | C24H32N2O4S2 |
| Molecular Weight | 476.66 g/mol |
| Exact Mass | 476.18 |
| IUPAC Name | 2-[(7S)-7-[5-(4-ethylphenyl)thiophen-2-yl]-4-[(E)-3-methylbut-1-enyl]-1,1-dioxo-1,4-thiazepan-7-yl]-N-hydroxyacetamide |
| SMILES | CCc1ccc(-c2ccc([C@@]3(CC(=O)NO)CCN(/C=C/C(C)C)CCS3(=O)=O)s2)cc1 |
| InChI | InChI=1S/C24H32N2O4S2/c1-4-19-5-7-20(8-6-19)21-9-10-22(31-21)24(17-23(27)25-28)12-14-26(13-11-18(2)3)15-16-32(24,29)30/h5-11,13,18,28H,4,12,14-17H2,1-3H3,(H,25,27)/b13-11+/t24-/m0/s1 |
| InChIKey | FQRYKPWCLDKYQO-CWSBKQHBSA-N |
| XLogP | 4.36 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.66 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|